C17H14F3NSe — CID 155664103
7,9-dimethyl-6-(2,2,2-trifluoroethylselanyl)phenanthridine (PubChem CID 155664103) has the molecular formula C17H14F3NSe and a molecular weight of 368.26 g/mol. Its IUPAC name is 7,9-dimethyl-6-(2,2,2-trifluoroethylselanyl)phenanthridine.
| Compound Name | 7,9-dimethyl-6-(2,2,2-trifluoroethylselanyl)phenanthridine |
|---|---|
| PubChem CID | 155664103 |
| Molecular Formula | C17H14F3NSe |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 7,9-dimethyl-6-(2,2,2-trifluoroethylselanyl)phenanthridine |
| SMILES | Cc1cc(C)c2c([Se]CC(F)(F)F)nc3ccccc3c2c1 |
| InChI | InChI=1S/C17H14F3NSe/c1-10-7-11(2)15-13(8-10)12-5-3-4-6-14(12)21-16(15)22-9-17(18,19)20/h3-8H,9H2,1-2H3 |
| InChIKey | VATOXCHZICCQTB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|