About 4-methylcyclopenta-1,3-diene-1-carbonitrile
4-methylcyclopenta-1,3-diene-1-carbonitrile (PubChem CID 15566433) has the molecular formula C7H7N
and a molecular weight of 105.14 g/mol. Its IUPAC name is 4-methylcyclopenta-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-methylcyclopenta-1,3-diene-1-carbonitrile |
| PubChem CID | 15566433 |
| Molecular Formula | C7H7N |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 4-methylcyclopenta-1,3-diene-1-carbonitrile |
| SMILES | CC1=CC=C(C#N)C1 |
| InChI | InChI=1S/C7H7N/c1-6-2-3-7(4-6)5-8/h2-3H,4H2,1H3 |
| InChIKey | IFLXIJWHFTZKSA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylcyclopenta-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylcyclopenta-1,3-diene-1-carbonitrile?
The IUPAC name of 4-methylcyclopenta-1,3-diene-1-carbonitrile (CID 15566433) is 4-methylcyclopenta-1,3-diene-1-carbonitrile.
What is the SMILES notation for 4-methylcyclopenta-1,3-diene-1-carbonitrile?
The canonical SMILES for 4-methylcyclopenta-1,3-diene-1-carbonitrile is CC1=CC=C(C#N)C1.
What is the InChIKey of 4-methylcyclopenta-1,3-diene-1-carbonitrile?
The InChIKey is IFLXIJWHFTZKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N/c1-6-2-3-7(4-6)5-8/h2-3H,4H2,1H3.
What are the key properties of 4-methylcyclopenta-1,3-diene-1-carbonitrile?
4-methylcyclopenta-1,3-diene-1-carbonitrile has a molecular weight of 105.14 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclopenta-1,3-diene-1-carbonitrile is sourced from PubChem (CID 15566433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).