About (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one
(6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one (PubChem CID 155664368) has the molecular formula C30H38O5
and a molecular weight of 478.63 g/mol. Its IUPAC name is (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one.
Molecular Properties
| Compound Name | (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one |
| PubChem CID | 155664368 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one |
| SMILES | CCOC(OCC)c1ccc(C=C2CCC/C(=C\c3ccc(C(OCC)OCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H38O5/c1-5-32-29(33-6-2)24-16-12-22(13-17-24)20-26-10-9-11-27(28(26)31)21-23-14-18-25(19-15-23)30(34-7-3)35-8-4/h12-21,29-30H,5-11H2,1-4H3/b26-20+,27-21? |
| InChIKey | UJOCWYJFYFOBLR-OJNLRUGGSA-N |
| XLogP | 7.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one?
The IUPAC name of (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one (CID 155664368) is (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one.
What is the SMILES notation for (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one?
The canonical SMILES for (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one is CCOC(OCC)c1ccc(C=C2CCC/C(=C\c3ccc(C(OCC)OCC)cc3)C2=O)cc1.
What is the InChIKey of (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one?
The InChIKey is UJOCWYJFYFOBLR-OJNLRUGGSA-N. The full InChI is InChI=1S/C30H38O5/c1-5-32-29(33-6-2)24-16-12-22(13-17-24)20-26-10-9-11-27(28(26)31)21-23-14-18-25(19-15-23)30(34-7-3)35-8-4/h12-21,29-30H,5-11H2,1-4H3/b26-20+,27-21?.
What are the key properties of (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one?
(6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one has a molecular weight of 478.63 g/mol, XLogP of 7.05, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-2,6-bis[[4-(diethoxymethyl)phenyl]methylidene]cyclohexan-1-one is sourced from PubChem (CID 155664368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).