About 4-nitroso-3,5-diphenyl-1H-pyrazole
4-nitroso-3,5-diphenyl-1H-pyrazole (PubChem CID 15566459) has the molecular formula C15H11N3O
and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-nitroso-3,5-diphenyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-nitroso-3,5-diphenyl-1H-pyrazole |
| PubChem CID | 15566459 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-nitroso-3,5-diphenyl-1H-pyrazole |
| SMILES | O=Nc1c(-c2ccccc2)n[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C15H11N3O/c19-18-15-13(11-7-3-1-4-8-11)16-17-14(15)12-9-5-2-6-10-12/h1-10H,(H,16,17) |
| InChIKey | YKPHKMIEBADBBC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-nitroso-3,5-diphenyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitroso-3,5-diphenyl-1H-pyrazole?
The IUPAC name of 4-nitroso-3,5-diphenyl-1H-pyrazole (CID 15566459) is 4-nitroso-3,5-diphenyl-1H-pyrazole.
What is the SMILES notation for 4-nitroso-3,5-diphenyl-1H-pyrazole?
The canonical SMILES for 4-nitroso-3,5-diphenyl-1H-pyrazole is O=Nc1c(-c2ccccc2)n[nH]c1-c1ccccc1.
What is the InChIKey of 4-nitroso-3,5-diphenyl-1H-pyrazole?
The InChIKey is YKPHKMIEBADBBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O/c19-18-15-13(11-7-3-1-4-8-11)16-17-14(15)12-9-5-2-6-10-12/h1-10H,(H,16,17).
What are the key properties of 4-nitroso-3,5-diphenyl-1H-pyrazole?
4-nitroso-3,5-diphenyl-1H-pyrazole has a molecular weight of 249.27 g/mol, XLogP of 4.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitroso-3,5-diphenyl-1H-pyrazole is sourced from PubChem (CID 15566459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).