C9H5F4NO2 — CID 155666114
5,6,7,7a-tetrafluoro-2-methyl-3aH-isoindole-1,3-dione (PubChem CID 155666114) has the molecular formula C9H5F4NO2 and a molecular weight of 235.14 g/mol. Its IUPAC name is 5,6,7,7a-tetrafluoro-2-methyl-3aH-isoindole-1,3-dione.
| Compound Name | 5,6,7,7a-tetrafluoro-2-methyl-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 155666114 |
| Molecular Formula | C9H5F4NO2 |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 5,6,7,7a-tetrafluoro-2-methyl-3aH-isoindole-1,3-dione |
| SMILES | CN1C(=O)C2C=C(F)C(F)=C(F)C2(F)C1=O |
| InChI | InChI=1S/C9H5F4NO2/c1-14-7(15)3-2-4(10)5(11)6(12)9(3,13)8(14)16/h2-3H,1H3 |
| InChIKey | XJHJOZYWMRZQBJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|