About 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one
2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one (PubChem CID 155668174) has the molecular formula C22H20O2
and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one.
Molecular Properties
| Compound Name | 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one |
| PubChem CID | 155668174 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one |
| SMILES | O=C1CC(Cc2ccccc2)(c2ccccc2)OC2=CC=CCC12 |
| InChI | InChI=1S/C22H20O2/c23-20-16-22(18-11-5-2-6-12-18,15-17-9-3-1-4-10-17)24-21-14-8-7-13-19(20)21/h1-12,14,19H,13,15-16H2 |
| InChIKey | DNDIZWFPCDIQIR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one?
The IUPAC name of 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one (CID 155668174) is 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one.
What is the SMILES notation for 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one?
The canonical SMILES for 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one is O=C1CC(Cc2ccccc2)(c2ccccc2)OC2=CC=CCC12.
What is the InChIKey of 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one?
The InChIKey is DNDIZWFPCDIQIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O2/c23-20-16-22(18-11-5-2-6-12-18,15-17-9-3-1-4-10-17)24-21-14-8-7-13-19(20)21/h1-12,14,19H,13,15-16H2.
What are the key properties of 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one?
2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one has a molecular weight of 316.40 g/mol, XLogP of 4.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-2-phenyl-4a,5-dihydro-3H-chromen-4-one is sourced from PubChem (CID 155668174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).