About 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid
3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid (PubChem CID 155668195) has the molecular formula C10H9F3O3
and a molecular weight of 234.17 g/mol. Its IUPAC name is 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid |
| PubChem CID | 155668195 |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid |
| SMILES | O=C(O)CCC1C=CC=C(C(F)(F)F)C1=O |
| InChI | InChI=1S/C10H9F3O3/c11-10(12,13)7-3-1-2-6(9(7)16)4-5-8(14)15/h1-3,6H,4-5H2,(H,14,15) |
| InChIKey | DDUDAEAZGGNKJY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid?
The IUPAC name of 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid (CID 155668195) is 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid.
What is the SMILES notation for 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid?
The canonical SMILES for 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid is O=C(O)CCC1C=CC=C(C(F)(F)F)C1=O.
What is the InChIKey of 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid?
The InChIKey is DDUDAEAZGGNKJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3O3/c11-10(12,13)7-3-1-2-6(9(7)16)4-5-8(14)15/h1-3,6H,4-5H2,(H,14,15).
What are the key properties of 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid?
3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid has a molecular weight of 234.17 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-oxo-5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propanoic acid is sourced from PubChem (CID 155668195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).