C38H48Br2S4 — CID 155668259
2,6-dibromo-4,8-bis[5-(2-ethyloctyl)thiophen-2-yl]thieno[2,3-f][1]benzothiole (PubChem CID 155668259) has the molecular formula C38H48Br2S4 and a molecular weight of 792.88 g/mol. Its IUPAC name is 2,6-dibromo-4,8-bis[5-(2-ethyloctyl)thiophen-2-yl]thieno[2,3-f][1]benzothiole.
| Compound Name | 2,6-dibromo-4,8-bis[5-(2-ethyloctyl)thiophen-2-yl]thieno[2,3-f][1]benzothiole |
|---|---|
| PubChem CID | 155668259 |
| Molecular Formula | C38H48Br2S4 |
| Molecular Weight | 792.88 g/mol |
| Exact Mass | 790.10 |
| IUPAC Name | 2,6-dibromo-4,8-bis[5-(2-ethyloctyl)thiophen-2-yl]thieno[2,3-f][1]benzothiole |
| SMILES | CCCCCCC(CC)Cc1ccc(-c2c3cc(Br)sc3c(-c3ccc(CC(CC)CCCCCC)s3)c3cc(Br)sc23)s1 |
| InChI | InChI=1S/C38H48Br2S4/c1-5-9-11-13-15-25(7-3)21-27-17-19-31(41-27)35-29-23-33(39)44-38(29)36(30-24-34(40)43-37(30)35)32-20-18-28(42-32)22-26(8-4)16-14-12-10-6-2/h17-20,23-26H,5-16,21-22H2,1-4H3 |
| InChIKey | MDYWONBTEOASGL-UHFFFAOYSA-N |
| XLogP | 16.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.88 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|