About 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole
3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole (PubChem CID 155668339) has the molecular formula C16H13NS
and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole.
Molecular Properties
| Compound Name | 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole |
| PubChem CID | 155668339 |
| Molecular Formula | C16H13NS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole |
| SMILES | c1csc(-c2c[nH]c3c2CCc2ccccc2-3)c1 |
| InChI | InChI=1S/C16H13NS/c1-2-5-12-11(4-1)7-8-13-14(10-17-16(12)13)15-6-3-9-18-15/h1-6,9-10,17H,7-8H2 |
| InChIKey | JUCYAMMJZDIXTH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole?
The IUPAC name of 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole (CID 155668339) is 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole.
What is the SMILES notation for 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole?
The canonical SMILES for 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole is c1csc(-c2c[nH]c3c2CCc2ccccc2-3)c1.
What is the InChIKey of 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole?
The InChIKey is JUCYAMMJZDIXTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NS/c1-2-5-12-11(4-1)7-8-13-14(10-17-16(12)13)15-6-3-9-18-15/h1-6,9-10,17H,7-8H2.
What are the key properties of 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole?
3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole has a molecular weight of 251.35 g/mol, XLogP of 4.51, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yl-4,5-dihydro-1H-benzo[g]indole is sourced from PubChem (CID 155668339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).