C22H21N3O4 — CID 155668633
6-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridine (PubChem CID 155668633) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridine.
| Compound Name | 6-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 155668633 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 6-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridine |
| SMILES | COc1ccc(-c2cc3c(cn2)ncn3-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H21N3O4/c1-26-16-7-5-14(6-8-16)17-11-19-18(12-23-17)24-13-25(19)15-9-20(27-2)22(29-4)21(10-15)28-3/h5-13H,1-4H3 |
| InChIKey | REWCNXATIVPZNV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |