C8H12N2O2 — CID 155669512
1,2,3,5,6,7-hexahydroimidazo[1,5-a]pyridin-4-ium-4-carboxylate (PubChem CID 155669512) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydroimidazo[1,5-a]pyridin-4-ium-4-carboxylate.
| Compound Name | 1,2,3,5,6,7-hexahydroimidazo[1,5-a]pyridin-4-ium-4-carboxylate |
|---|---|
| PubChem CID | 155669512 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1,2,3,5,6,7-hexahydroimidazo[1,5-a]pyridin-4-ium-4-carboxylate |
| SMILES | O=C([O-])[N+]12CCCC=C1CNC2 |
| InChI | InChI=1S/C8H12N2O2/c11-8(12)10-4-2-1-3-7(10)5-9-6-10/h3,9H,1-2,4-6H2 |
| InChIKey | CFRSMMNWISUZQV-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|