C19H12F2N4O3 — CID 155669855
6-[2-(2,4-difluorophenoxy)-5-nitrophenyl]-3-methyl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 155669855) has the molecular formula C19H12F2N4O3 and a molecular weight of 382.33 g/mol. Its IUPAC name is 6-[2-(2,4-difluorophenoxy)-5-nitrophenyl]-3-methyl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 6-[2-(2,4-difluorophenoxy)-5-nitrophenyl]-3-methyl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 155669855 |
| Molecular Formula | C19H12F2N4O3 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 6-[2-(2,4-difluorophenoxy)-5-nitrophenyl]-3-methyl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1nnc2ccc(-c3cc([N+](=O)[O-])ccc3Oc3ccc(F)cc3F)cn12 |
| InChI | InChI=1S/C19H12F2N4O3/c1-11-22-23-19-7-2-12(10-24(11)19)15-9-14(25(26)27)4-6-17(15)28-18-5-3-13(20)8-16(18)21/h2-10H,1H3 |
| InChIKey | PAQAFXKYZRRHQP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|