About 3,7,8-trimethylisoquinoline
3,7,8-trimethylisoquinoline (PubChem CID 155669978) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3,7,8-trimethylisoquinoline.
Molecular Properties
| Compound Name | 3,7,8-trimethylisoquinoline |
| PubChem CID | 155669978 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3,7,8-trimethylisoquinoline |
| SMILES | Cc1cc2ccc(C)c(C)c2cn1 |
| InChI | InChI=1S/C12H13N/c1-8-4-5-11-6-9(2)13-7-12(11)10(8)3/h4-7H,1-3H3 |
| InChIKey | UZEFQPZFOPMNMQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,7,8-trimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7,8-trimethylisoquinoline?
The IUPAC name of 3,7,8-trimethylisoquinoline (CID 155669978) is 3,7,8-trimethylisoquinoline.
What is the SMILES notation for 3,7,8-trimethylisoquinoline?
The canonical SMILES for 3,7,8-trimethylisoquinoline is Cc1cc2ccc(C)c(C)c2cn1.
What is the InChIKey of 3,7,8-trimethylisoquinoline?
The InChIKey is UZEFQPZFOPMNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N/c1-8-4-5-11-6-9(2)13-7-12(11)10(8)3/h4-7H,1-3H3.
What are the key properties of 3,7,8-trimethylisoquinoline?
3,7,8-trimethylisoquinoline has a molecular weight of 171.24 g/mol, XLogP of 3.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7,8-trimethylisoquinoline is sourced from PubChem (CID 155669978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).