About 1-chlorocyclohexa-2,4-diene-1-thiol
1-chlorocyclohexa-2,4-diene-1-thiol (PubChem CID 155669989) has the molecular formula C6H7ClS
and a molecular weight of 146.64 g/mol. Its IUPAC name is 1-chlorocyclohexa-2,4-diene-1-thiol.
Molecular Properties
| Compound Name | 1-chlorocyclohexa-2,4-diene-1-thiol |
| PubChem CID | 155669989 |
| Molecular Formula | C6H7ClS |
| Molecular Weight | 146.64 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 1-chlorocyclohexa-2,4-diene-1-thiol |
| SMILES | SC1(Cl)C=CC=CC1 |
| InChI | InChI=1S/C6H7ClS/c7-6(8)4-2-1-3-5-6/h1-4,8H,5H2 |
| InChIKey | DRGRJMMKCKGBET-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.64 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorocyclohexa-2,4-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorocyclohexa-2,4-diene-1-thiol?
The IUPAC name of 1-chlorocyclohexa-2,4-diene-1-thiol (CID 155669989) is 1-chlorocyclohexa-2,4-diene-1-thiol.
What is the SMILES notation for 1-chlorocyclohexa-2,4-diene-1-thiol?
The canonical SMILES for 1-chlorocyclohexa-2,4-diene-1-thiol is SC1(Cl)C=CC=CC1.
What is the InChIKey of 1-chlorocyclohexa-2,4-diene-1-thiol?
The InChIKey is DRGRJMMKCKGBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClS/c7-6(8)4-2-1-3-5-6/h1-4,8H,5H2.
What are the key properties of 1-chlorocyclohexa-2,4-diene-1-thiol?
1-chlorocyclohexa-2,4-diene-1-thiol has a molecular weight of 146.64 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorocyclohexa-2,4-diene-1-thiol is sourced from PubChem (CID 155669989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).