C28H32F3N3O2S — CID 155670305
1-[3-[2-methyl-3-[3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-(trifluoromethyl)phenyl]phenoxy]propyl]piperidin-4-ol (PubChem CID 155670305) has the molecular formula C28H32F3N3O2S and a molecular weight of 531.64 g/mol. Its IUPAC name is 1-[3-[2-methyl-3-[3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-(trifluoromethyl)phenyl]phenoxy]propyl]piperidin-4-ol.
| Compound Name | 1-[3-[2-methyl-3-[3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-(trifluoromethyl)phenyl]phenoxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 155670305 |
| Molecular Formula | C28H32F3N3O2S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 1-[3-[2-methyl-3-[3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-(trifluoromethyl)phenyl]phenoxy]propyl]piperidin-4-ol |
| SMILES | Cc1c(OCCCN2CCC(O)CC2)cccc1-c1cccc(-c2nc3c(s2)CNCC3)c1C(F)(F)F |
| InChI | InChI=1S/C28H32F3N3O2S/c1-18-20(5-3-8-24(18)36-16-4-13-34-14-10-19(35)11-15-34)21-6-2-7-22(26(21)28(29,30)31)27-33-23-9-12-32-17-25(23)37-27/h2-3,5-8,19,32,35H,4,9-17H2,1H3 |
| InChIKey | BNTSNUTVKVDPIN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|