C11H2F18O2 — CID 155670536
3,3,4,4,5,5-hexafluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene (PubChem CID 155670536) has the molecular formula C11H2F18O2 and a molecular weight of 508.10 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene |
|---|---|
| PubChem CID | 155670536 |
| Molecular Formula | C11H2F18O2 |
| Molecular Weight | 508.10 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene |
| SMILES | FC(F)(F)C(OC1=C(OC(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H2F18O2/c12-5(13)1(30-3(7(16,17)18)8(19,20)21)2(6(14,15)11(5,28)29)31-4(9(22,23)24)10(25,26)27/h3-4H |
| InChIKey | YAOXWOHOXNCIHF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.10 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|