C17H12F20O4 — CID 155670564
3,3,4,4-tetrafluoro-1,2,5,5-tetrakis(2,2,3,3-tetrafluoropropoxy)cyclopentene (PubChem CID 155670564) has the molecular formula C17H12F20O4 and a molecular weight of 660.24 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1,2,5,5-tetrakis(2,2,3,3-tetrafluoropropoxy)cyclopentene.
| Compound Name | 3,3,4,4-tetrafluoro-1,2,5,5-tetrakis(2,2,3,3-tetrafluoropropoxy)cyclopentene |
|---|---|
| PubChem CID | 155670564 |
| Molecular Formula | C17H12F20O4 |
| Molecular Weight | 660.24 g/mol |
| Exact Mass | 660.04 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1,2,5,5-tetrakis(2,2,3,3-tetrafluoropropoxy)cyclopentene |
| SMILES | FC(F)C(F)(F)COC1=C(OCC(F)(F)C(F)F)C(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17H12F20O4/c18-7(19)11(26,27)1-38-5-6(39-2-12(28,29)8(20)21)16(17(36,37)15(5,34)35,40-3-13(30,31)9(22)23)41-4-14(32,33)10(24)25/h7-10H,1-4H2 |
| InChIKey | QKPRHMXAXHXMIK-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.24 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|