About (E)-ethylidenethiourea;oxozinc
(E)-ethylidenethiourea;oxozinc (PubChem CID 155670628) has the molecular formula C3H6N2OSZn
and a molecular weight of 183.55 g/mol. Its IUPAC name is (E)-ethylidenethiourea;oxozinc.
Molecular Properties
| Compound Name | (E)-ethylidenethiourea;oxozinc |
| PubChem CID | 155670628 |
| Molecular Formula | C3H6N2OSZn |
| Molecular Weight | 183.55 g/mol |
| Exact Mass | 181.95 |
| IUPAC Name | (E)-ethylidenethiourea;oxozinc |
| SMILES | C/C=N/C(N)=S.O=[Zn] |
| InChI | InChI=1S/C3H6N2S.O.Zn/c1-2-5-3(4)6;;/h2H,1H3,(H2,4,6);;/b5-2+;; |
| InChIKey | KXOBUSNYYXZBSB-OPIVVEOKSA-N |
| XLogP | 0.20 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.55 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-ethylidenethiourea;oxozinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-ethylidenethiourea;oxozinc?
The IUPAC name of (E)-ethylidenethiourea;oxozinc (CID 155670628) is (E)-ethylidenethiourea;oxozinc.
What is the SMILES notation for (E)-ethylidenethiourea;oxozinc?
The canonical SMILES for (E)-ethylidenethiourea;oxozinc is C/C=N/C(N)=S.O=[Zn].
What is the InChIKey of (E)-ethylidenethiourea;oxozinc?
The InChIKey is KXOBUSNYYXZBSB-OPIVVEOKSA-N. The full InChI is InChI=1S/C3H6N2S.O.Zn/c1-2-5-3(4)6;;/h2H,1H3,(H2,4,6);;/b5-2+;;.
What are the key properties of (E)-ethylidenethiourea;oxozinc?
(E)-ethylidenethiourea;oxozinc has a molecular weight of 183.55 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-ethylidenethiourea;oxozinc is sourced from PubChem (CID 155670628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).