About 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene
5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene (PubChem CID 155670753) has the molecular formula C12H6F3N3
and a molecular weight of 249.20 g/mol. Its IUPAC name is 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene.
Molecular Properties
| Compound Name | 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene |
| PubChem CID | 155670753 |
| Molecular Formula | C12H6F3N3 |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene |
| SMILES | [N-]=[N+]=Nc1cc(F)c(-c2cccc(F)c2)c(F)c1 |
| InChI | InChI=1S/C12H6F3N3/c13-8-3-1-2-7(4-8)12-10(14)5-9(17-18-16)6-11(12)15/h1-6H |
| InChIKey | YYXQPEHAHHHDHC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene?
The IUPAC name of 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene (CID 155670753) is 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene.
What is the SMILES notation for 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene?
The canonical SMILES for 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene is [N-]=[N+]=Nc1cc(F)c(-c2cccc(F)c2)c(F)c1.
What is the InChIKey of 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene?
The InChIKey is YYXQPEHAHHHDHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F3N3/c13-8-3-1-2-7(4-8)12-10(14)5-9(17-18-16)6-11(12)15/h1-6H.
What are the key properties of 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene?
5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene has a molecular weight of 249.20 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-1,3-difluoro-2-(3-fluorophenyl)benzene is sourced from PubChem (CID 155670753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).