C23H23N5OS — CID 155671262
3,7-dimethyl-4-(3-phenylmethoxypropyl)-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene (PubChem CID 155671262) has the molecular formula C23H23N5OS and a molecular weight of 417.54 g/mol. Its IUPAC name is 3,7-dimethyl-4-(3-phenylmethoxypropyl)-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene.
| Compound Name | 3,7-dimethyl-4-(3-phenylmethoxypropyl)-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 155671262 |
| Molecular Formula | C23H23N5OS |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3,7-dimethyl-4-(3-phenylmethoxypropyl)-11-(1H-pyrazol-5-yl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
| SMILES | Cc1nc2cc(-c3ccn[nH]3)sc2c2c1nc(CCCOCc1ccccc1)n2C |
| InChI | InChI=1S/C23H23N5OS/c1-15-21-22(23-18(25-15)13-19(30-23)17-10-11-24-27-17)28(2)20(26-21)9-6-12-29-14-16-7-4-3-5-8-16/h3-5,7-8,10-11,13H,6,9,12,14H2,1-2H3,(H,24,27) |
| InChIKey | ZQCJEVUVEKOVHN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|