About 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride
2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride (PubChem CID 155671299) has the molecular formula C13H18BrCl2N3
and a molecular weight of 367.12 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride |
| PubChem CID | 155671299 |
| Molecular Formula | C13H18BrCl2N3 |
| Molecular Weight | 367.12 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride |
| SMILES | Brc1ccc(C2([C@@H]3CCCN3)NC=CN2)cc1.Cl.Cl |
| InChI | InChI=1S/C13H16BrN3.2ClH/c14-11-5-3-10(4-6-11)13(16-8-9-17-13)12-2-1-7-15-12;;/h3-6,8-9,12,15-17H,1-2,7H2;2*1H/t12-;;/m0../s1 |
| InChIKey | LPOPEQTXTIEUMZ-LTCKWSDVSA-N |
| XLogP | 2.86 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.12 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride?
The IUPAC name of 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride (CID 155671299) is 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride.
What is the SMILES notation for 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride?
The canonical SMILES for 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride is Brc1ccc(C2([C@@H]3CCCN3)NC=CN2)cc1.Cl.Cl.
What is the InChIKey of 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride?
The InChIKey is LPOPEQTXTIEUMZ-LTCKWSDVSA-N. The full InChI is InChI=1S/C13H16BrN3.2ClH/c14-11-5-3-10(4-6-11)13(16-8-9-17-13)12-2-1-7-15-12;;/h3-6,8-9,12,15-17H,1-2,7H2;2*1H/t12-;;/m0../s1.
What are the key properties of 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride?
2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride has a molecular weight of 367.12 g/mol, XLogP of 2.86, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-2-[(2S)-pyrrolidin-2-yl]-1,3-dihydroimidazole;dihydrochloride is sourced from PubChem (CID 155671299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).