C29H24F5N3O7 — CID 155671397
2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-2,6-difluorophenyl]-2-oxo-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 155671397) has the molecular formula C29H24F5N3O7 and a molecular weight of 621.52 g/mol. Its IUPAC name is 2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-2,6-difluorophenyl]-2-oxo-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-2,6-difluorophenyl]-2-oxo-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 155671397 |
| Molecular Formula | C29H24F5N3O7 |
| Molecular Weight | 621.52 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | 2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-2,6-difluorophenyl]-2-oxo-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCOc1cc2ncnc(Oc3cc(F)c(C(=O)C(=O)Nc4cccc(C(F)(F)F)c4)c(F)c3)c2cc1OCCOC |
| InChI | InChI=1S/C29H24F5N3O7/c1-40-6-8-42-23-13-19-22(14-24(23)43-9-7-41-2)35-15-36-28(19)44-18-11-20(30)25(21(31)12-18)26(38)27(39)37-17-5-3-4-16(10-17)29(32,33)34/h3-5,10-15H,6-9H2,1-2H3,(H,37,39) |
| InChIKey | IBTVIUPTDZLOPZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|