C13H15FN2O4 — CID 155671608
2-(2,6-dihydroxypiperidin-3-yl)-5-fluoro-3a,7a-dihydroisoindole-1,3-dione (PubChem CID 155671608) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 2-(2,6-dihydroxypiperidin-3-yl)-5-fluoro-3a,7a-dihydroisoindole-1,3-dione.
| Compound Name | 2-(2,6-dihydroxypiperidin-3-yl)-5-fluoro-3a,7a-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 155671608 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-(2,6-dihydroxypiperidin-3-yl)-5-fluoro-3a,7a-dihydroisoindole-1,3-dione |
| SMILES | O=C1C2C=CC(F)=CC2C(=O)N1C1CCC(O)NC1O |
| InChI | InChI=1S/C13H15FN2O4/c14-6-1-2-7-8(5-6)13(20)16(12(7)19)9-3-4-10(17)15-11(9)18/h1-2,5,7-11,15,17-18H,3-4H2 |
| InChIKey | ACTOILSBZONJLA-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|