C19H34N2O — CID 155671720
8-hydroxy-2,2,14,14-tetramethylpentadecanedinitrile (PubChem CID 155671720) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is 8-hydroxy-2,2,14,14-tetramethylpentadecanedinitrile.
| Compound Name | 8-hydroxy-2,2,14,14-tetramethylpentadecanedinitrile |
|---|---|
| PubChem CID | 155671720 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 8-hydroxy-2,2,14,14-tetramethylpentadecanedinitrile |
| SMILES | CC(C)(C#N)CCCCCC(O)CCCCCC(C)(C)C#N |
| InChI | InChI=1S/C19H34N2O/c1-18(2,15-20)13-9-5-7-11-17(22)12-8-6-10-14-19(3,4)16-21/h17,22H,5-14H2,1-4H3 |
| InChIKey | JQBOGCZVQIAXST-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|