C24H26N2O5S — CID 155671917
1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-prop-1-ynylthieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 155671917) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is 1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-prop-1-ynylthieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-prop-1-ynylthieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155671917 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-[(2R)-2-(2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-5-methyl-6-prop-1-ynylthieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC#Cc1sc2c(c1C)c(=O)[nH]c(=O)n2C[C@H](OC1CCOCC1)c1ccccc1OC |
| InChI | InChI=1S/C24H26N2O5S/c1-4-7-20-15(2)21-22(27)25-24(28)26(23(21)32-20)14-19(31-16-10-12-30-13-11-16)17-8-5-6-9-18(17)29-3/h5-6,8-9,16,19H,10-14H2,1-3H3,(H,25,27,28)/t19-/m0/s1 |
| InChIKey | STGMYOANRRWRJZ-IBGZPJMESA-N |
| XLogP | 3.38 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|