About 1,2,3,4-tetrachlorobutane
1,2,3,4-tetrachlorobutane (PubChem CID 155672172) has the molecular formula C8H12Cl8
and a molecular weight of 391.81 g/mol. Its IUPAC name is 1,2,3,4-tetrachlorobutane.
Molecular Properties
| Compound Name | 1,2,3,4-tetrachlorobutane |
| PubChem CID | 155672172 |
| Molecular Formula | C8H12Cl8 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 387.84 |
| IUPAC Name | 1,2,3,4-tetrachlorobutane |
| SMILES | ClCC(Cl)C(Cl)CCl.ClCC(Cl)C(Cl)CCl |
| InChI | InChI=1S/2C4H6Cl4/c2*5-1-3(7)4(8)2-6/h2*3-4H,1-2H2 |
| InChIKey | RWPIROCPWBKVIR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3,4-tetrachlorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetrachlorobutane?
The IUPAC name of 1,2,3,4-tetrachlorobutane (CID 155672172) is 1,2,3,4-tetrachlorobutane.
What is the SMILES notation for 1,2,3,4-tetrachlorobutane?
The canonical SMILES for 1,2,3,4-tetrachlorobutane is ClCC(Cl)C(Cl)CCl.ClCC(Cl)C(Cl)CCl.
What is the InChIKey of 1,2,3,4-tetrachlorobutane?
The InChIKey is RWPIROCPWBKVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6Cl4/c2*5-1-3(7)4(8)2-6/h2*3-4H,1-2H2.
What are the key properties of 1,2,3,4-tetrachlorobutane?
1,2,3,4-tetrachlorobutane has a molecular weight of 391.81 g/mol, XLogP of 5.36, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetrachlorobutane is sourced from PubChem (CID 155672172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).