C17H33BO3 — CID 155672220
2-[4-(ethoxymethyl)-4-ethylcyclohexyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 155672220) has the molecular formula C17H33BO3 and a molecular weight of 296.26 g/mol. Its IUPAC name is 2-[4-(ethoxymethyl)-4-ethylcyclohexyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(ethoxymethyl)-4-ethylcyclohexyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 155672220 |
| Molecular Formula | C17H33BO3 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 2-[4-(ethoxymethyl)-4-ethylcyclohexyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOCC1(CC)CCC(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C17H33BO3/c1-7-17(13-19-8-2)11-9-14(10-12-17)18-20-15(3,4)16(5,6)21-18/h14H,7-13H2,1-6H3 |
| InChIKey | VMCHLDFLGRPJHX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|