C10H6F7NO2S — CID 155672633
N-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propylidene]benzenesulfonamide (PubChem CID 155672633) has the molecular formula C10H6F7NO2S and a molecular weight of 337.22 g/mol. Its IUPAC name is N-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propylidene]benzenesulfonamide.
| Compound Name | N-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 155672633 |
| Molecular Formula | C10H6F7NO2S |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | N-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propylidene]benzenesulfonamide |
| SMILES | O=S(=O)(N=CC(F)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H6F7NO2S/c11-8(9(12,13)14,10(15,16)17)6-18-21(19,20)7-4-2-1-3-5-7/h1-6H |
| InChIKey | YFRNZNBNJJBTOP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|