About 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine
5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine (PubChem CID 155672832) has the molecular formula C22H20N4
and a molecular weight of 340.43 g/mol. Its IUPAC name is 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine.
Molecular Properties
| Compound Name | 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine |
| PubChem CID | 155672832 |
| Molecular Formula | C22H20N4 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine |
| SMILES | CN(c1ccccc1)c1c(Cc2ccccc2)nnn1-c1ccccc1 |
| InChI | InChI=1S/C22H20N4/c1-25(19-13-7-3-8-14-19)22-21(17-18-11-5-2-6-12-18)23-24-26(22)20-15-9-4-10-16-20/h2-16H,17H2,1H3 |
| InChIKey | UWKXNZSRWYJBMN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine?
The IUPAC name of 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine (CID 155672832) is 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine.
What is the SMILES notation for 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine?
The canonical SMILES for 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine is CN(c1ccccc1)c1c(Cc2ccccc2)nnn1-c1ccccc1.
What is the InChIKey of 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine?
The InChIKey is UWKXNZSRWYJBMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4/c1-25(19-13-7-3-8-14-19)22-21(17-18-11-5-2-6-12-18)23-24-26(22)20-15-9-4-10-16-20/h2-16H,17H2,1H3.
What are the key properties of 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine?
5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine has a molecular weight of 340.43 g/mol, XLogP of 4.63, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-N-methyl-N,3-diphenyltriazol-4-amine is sourced from PubChem (CID 155672832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).