2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid

C20H24O2S — CID 155672864

IUPAC2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid
SMILESCC(=CCCCCCCSc1ccc2ccccc2c1)C(=O)O
InChIInChI=1S/C20H24O2S/c1-16(20(21)22)9-5-3-2-4-8-14-23-19-13-12-17-10-6-7-11-18(17)15-19/h6-7,9-13,15H,2-5,8,14H2,1H3,(H,21,22)
InChIKeyGDWJWCHFQIIHEX-UHFFFAOYSA-N
MW328.48 g/mol
LogP5.91
Rot. Bonds9

About 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid

2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid (PubChem CID 155672864) has the molecular formula C20H24O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid.

Molecular Properties

Compound Name2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid
PubChem CID155672864
Molecular FormulaC20H24O2S
Molecular Weight328.48 g/mol
Exact Mass328.15
IUPAC Name2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid
SMILESCC(=CCCCCCCSc1ccc2ccccc2c1)C(=O)O
InChIInChI=1S/C20H24O2S/c1-16(20(21)22)9-5-3-2-4-8-14-23-19-13-12-17-10-6-7-11-18(17)15-19/h6-7,9-13,15H,2-5,8,14H2,1H3,(H,21,22)
InChIKeyGDWJWCHFQIIHEX-UHFFFAOYSA-N
XLogP5.91
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms23
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500328.48
LogP ≤ 55.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(E)-2-methyl-9-phenoxynon-2-enoic acid
CID 118914903
methyl 6-naphthalen-2-ylsulfanylhexanoate
CID 135366329
5-naphthalen-2-ylsulfanylpentanehydrazide
CID 55213311
(E)-2-methyl-8-phenyloct-2-enoic acid
CID 66912442
formic acid;2-propylsulfanylnaphthalene
CID 143073136
2,13-dimethyltetradeca-2,12-dienedioic acid
CID 173279289
2-[4-(4-naphthalen-2-ylsulfanylbutoxy)phenyl]-2-oxoacetic acid
CID 19004425
2-methyl-5-(phenylsulfanylmethoxy)pent-2-enoic acid
CID 155672872
2-(4-chlorobutylsulfanyl)naphthalene
CID 63501641
(E)-2-methyl-11-phenylmethoxyundec-2-enoic acid
CID 142611207
2-(2-bromoethylsulfanyl)naphthalene
CID 43519120
2-[(2,2-dimethylcyclopropanecarbonyl)amino]-7-phenylsulfanylhept-2-enoic acid
CID 54090641

Frequently Asked Questions

What is the IUPAC name of 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid?
The IUPAC name of 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid (CID 155672864) is 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid.
What is the SMILES notation for 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid?
The canonical SMILES for 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid is CC(=CCCCCCCSc1ccc2ccccc2c1)C(=O)O.
What is the InChIKey of 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid?
The InChIKey is GDWJWCHFQIIHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O2S/c1-16(20(21)22)9-5-3-2-4-8-14-23-19-13-12-17-10-6-7-11-18(17)15-19/h6-7,9-13,15H,2-5,8,14H2,1H3,(H,21,22).
What are the key properties of 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid?
2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid has a molecular weight of 328.48 g/mol, XLogP of 5.91, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-9-naphthalen-2-ylsulfanylnon-2-enoic acid is sourced from PubChem (CID 155672864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).