C22H23Cl2FN8O — CID 155673156
[6-[(1R,2S,3S,5S)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-3-(3,4-dichloro-2-ethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol (PubChem CID 155673156) has the molecular formula C22H23Cl2FN8O and a molecular weight of 505.39 g/mol. Its IUPAC name is [6-[(1R,2S,3S,5S)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-3-(3,4-dichloro-2-ethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol.
| Compound Name | [6-[(1R,2S,3S,5S)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-3-(3,4-dichloro-2-ethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol |
|---|---|
| PubChem CID | 155673156 |
| Molecular Formula | C22H23Cl2FN8O |
| Molecular Weight | 505.39 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [6-[(1R,2S,3S,5S)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-3-(3,4-dichloro-2-ethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol |
| SMILES | CCn1nc2ccc(-c3[nH]nc4nc(N5[C@H]6CC[C@@H]5[C@@H](F)[C@@H](N)C6)c(CO)nc34)c(Cl)c2c1Cl |
| InChI | InChI=1S/C22H23Cl2FN8O/c1-2-32-20(24)15-12(31-32)5-4-10(16(15)23)18-19-21(30-29-18)28-22(13(8-34)27-19)33-9-3-6-14(33)17(25)11(26)7-9/h4-5,9,11,14,17,34H,2-3,6-8,26H2,1H3,(H,28,29,30)/t9-,11-,14+,17-/m0/s1 |
| InChIKey | PHVPCUSKIPNPBP-HQCRVGEVSA-N |
| XLogP | 3.60 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |