C22H24ClFN8O — CID 155673204
[6-[(1R,2S,3S,5S)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-3-(4-chloro-2-ethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol (PubChem CID 155673204) has the molecular formula C22H24ClFN8O and a molecular weight of 470.94 g/mol. Its IUPAC name is [6-[(1R,2S,3S,5S)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-3-(4-chloro-2-ethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol.
| Compound Name | [6-[(1R,2S,3S,5S)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-3-(4-chloro-2-ethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol |
|---|---|
| PubChem CID | 155673204 |
| Molecular Formula | C22H24ClFN8O |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [6-[(1R,2S,3S,5S)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octan-8-yl]-3-(4-chloro-2-ethylindazol-5-yl)-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol |
| SMILES | CCn1cc2c(Cl)c(-c3[nH]nc4nc(N5[C@H]6CC[C@@H]5[C@@H](F)[C@@H](N)C6)c(CO)nc34)ccc2n1 |
| InChI | InChI=1S/C22H24ClFN8O/c1-2-31-8-12-14(30-31)5-4-11(17(12)23)19-20-21(29-28-19)27-22(15(9-33)26-20)32-10-3-6-16(32)18(24)13(25)7-10/h4-5,8,10,13,16,18,33H,2-3,6-7,9,25H2,1H3,(H,27,28,29)/t10-,13-,16+,18-/m0/s1 |
| InChIKey | RUAXAYINMWNXGY-ZOBBZUTBSA-N |
| XLogP | 2.94 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |