C22H24ClFN8 — CID 155673214
(1R,2S,3S,5S)-8-[3-(4-chloro-2-ethylindazol-5-yl)-5-methyl-2H-pyrazolo[3,4-b]pyrazin-6-yl]-2-fluoro-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 155673214) has the molecular formula C22H24ClFN8 and a molecular weight of 454.94 g/mol. Its IUPAC name is (1R,2S,3S,5S)-8-[3-(4-chloro-2-ethylindazol-5-yl)-5-methyl-2H-pyrazolo[3,4-b]pyrazin-6-yl]-2-fluoro-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | (1R,2S,3S,5S)-8-[3-(4-chloro-2-ethylindazol-5-yl)-5-methyl-2H-pyrazolo[3,4-b]pyrazin-6-yl]-2-fluoro-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 155673214 |
| Molecular Formula | C22H24ClFN8 |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (1R,2S,3S,5S)-8-[3-(4-chloro-2-ethylindazol-5-yl)-5-methyl-2H-pyrazolo[3,4-b]pyrazin-6-yl]-2-fluoro-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CCn1cc2c(Cl)c(-c3[nH]nc4nc(N5[C@H]6CC[C@@H]5[C@@H](F)[C@@H](N)C6)c(C)nc34)ccc2n1 |
| InChI | InChI=1S/C22H24ClFN8/c1-3-31-9-13-15(30-31)6-5-12(17(13)23)19-20-21(29-28-19)27-22(10(2)26-20)32-11-4-7-16(32)18(24)14(25)8-11/h5-6,9,11,14,16,18H,3-4,7-8,25H2,1-2H3,(H,27,28,29)/t11-,14-,16+,18-/m0/s1 |
| InChIKey | RNPSGOWCTZLYNP-DQMHSYKWSA-N |
| XLogP | 3.76 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |