C32H36N6O4 — CID 155673267
4-[[1-[1-(1-cyclobutyl-3-cyclopropylprop-2-ynyl)piperidin-4-yl]pyrazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 155673267) has the molecular formula C32H36N6O4 and a molecular weight of 568.68 g/mol. Its IUPAC name is 4-[[1-[1-(1-cyclobutyl-3-cyclopropylprop-2-ynyl)piperidin-4-yl]pyrazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[1-[1-(1-cyclobutyl-3-cyclopropylprop-2-ynyl)piperidin-4-yl]pyrazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 155673267 |
| Molecular Formula | C32H36N6O4 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | 4-[[1-[1-(1-cyclobutyl-3-cyclopropylprop-2-ynyl)piperidin-4-yl]pyrazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCc4cnn(C5CCN(C(C#CC6CC6)C6CCC6)CC5)c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H36N6O4/c39-28-12-11-27(30(40)35-28)38-31(41)24-5-2-6-25(29(24)32(38)42)33-17-21-18-34-37(19-21)23-13-15-36(16-14-23)26(22-3-1-4-22)10-9-20-7-8-20/h2,5-6,18-20,22-23,26-27,33H,1,3-4,7-8,11-17H2,(H,35,39,40) |
| InChIKey | BNXSBVMVHJTCBP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|