C32H28F2N6O5S — CID 155674051
1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[6-(2-oxopiperidin-1-yl)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 155674051) has the molecular formula C32H28F2N6O5S and a molecular weight of 646.68 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[6-(2-oxopiperidin-1-yl)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[6-(2-oxopiperidin-1-yl)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155674051 |
| Molecular Formula | C32H28F2N6O5S |
| Molecular Weight | 646.68 g/mol |
| Exact Mass | 646.18 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[6-(2-oxopiperidin-1-yl)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CN(C)Cc1c(-c2ccc([N+](=O)[O-])cc2)sc2c1c(=O)n(-c1cccc(N3CCCCC3=O)n1)c(=O)n2Cc1c(F)cccc1F |
| InChI | InChI=1S/C32H28F2N6O5S/c1-36(2)17-22-28-30(42)39(26-10-6-9-25(35-26)37-16-4-3-11-27(37)41)32(43)38(18-21-23(33)7-5-8-24(21)34)31(28)46-29(22)19-12-14-20(15-13-19)40(44)45/h5-10,12-15H,3-4,11,16-18H2,1-2H3 |
| InChIKey | MDCUXEUJRKJMGJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 123.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.68 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|