About 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene
1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene (PubChem CID 155674738) has the molecular formula C19H28O
and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene |
| PubChem CID | 155674738 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene |
| SMILES | CC(=COC(C)C1CCCC(C)(C)C1)c1ccccc1 |
| InChI | InChI=1S/C19H28O/c1-15(17-9-6-5-7-10-17)14-20-16(2)18-11-8-12-19(3,4)13-18/h5-7,9-10,14,16,18H,8,11-13H2,1-4H3 |
| InChIKey | WWONPZWJTLFYGW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene?
The IUPAC name of 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene (CID 155674738) is 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene.
What is the SMILES notation for 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene?
The canonical SMILES for 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene is CC(=COC(C)C1CCCC(C)(C)C1)c1ccccc1.
What is the InChIKey of 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene?
The InChIKey is WWONPZWJTLFYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O/c1-15(17-9-6-5-7-10-17)14-20-16(2)18-11-8-12-19(3,4)13-18/h5-7,9-10,14,16,18H,8,11-13H2,1-4H3.
What are the key properties of 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene?
1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene has a molecular weight of 272.43 g/mol, XLogP of 5.67, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,3-dimethylcyclohexyl)ethoxy]prop-1-en-2-ylbenzene is sourced from PubChem (CID 155674738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).