C16H19NO4S — CID 155676037
4-[5-(3-aminopropyl)-6-methoxy-1-benzothiophen-2-yl]-4-oxobutanoic acid (PubChem CID 155676037) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-[5-(3-aminopropyl)-6-methoxy-1-benzothiophen-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-(3-aminopropyl)-6-methoxy-1-benzothiophen-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 155676037 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-[5-(3-aminopropyl)-6-methoxy-1-benzothiophen-2-yl]-4-oxobutanoic acid |
| SMILES | COc1cc2sc(C(=O)CCC(=O)O)cc2cc1CCCN |
| InChI | InChI=1S/C16H19NO4S/c1-21-13-9-14-11(7-10(13)3-2-6-17)8-15(22-14)12(18)4-5-16(19)20/h7-9H,2-6,17H2,1H3,(H,19,20) |
| InChIKey | VELJZIYPOZLECN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |