C11H19FN2O — CID 155676315
6-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-1,2,3,6-tetrahydropyridine (PubChem CID 155676315) has the molecular formula C11H19FN2O and a molecular weight of 214.28 g/mol. Its IUPAC name is 6-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-1,2,3,6-tetrahydropyridine.
| Compound Name | 6-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 155676315 |
| Molecular Formula | C11H19FN2O |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 6-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-1,2,3,6-tetrahydropyridine |
| SMILES | CN1C[C@H](F)C[C@H]1COC1C=CCCN1 |
| InChI | InChI=1S/C11H19FN2O/c1-14-7-9(12)6-10(14)8-15-11-4-2-3-5-13-11/h2,4,9-11,13H,3,5-8H2,1H3/t9-,10+,11?/m1/s1 |
| InChIKey | UYBCORODOBMYHY-JKIOLJMWSA-N |
| XLogP | 0.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|