About (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid
(2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid (PubChem CID 155676462) has the molecular formula C13H11BrO3
and a molecular weight of 295.13 g/mol. Its IUPAC name is (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid.
Molecular Properties
| Compound Name | (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid |
| PubChem CID | 155676462 |
| Molecular Formula | C13H11BrO3 |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid |
| SMILES | O=C(O)/C=C1\CCCc2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C13H11BrO3/c14-10-5-4-8-2-1-3-9(6-12(15)16)13(17)11(8)7-10/h4-7H,1-3H2,(H,15,16)/b9-6+ |
| InChIKey | MNTABAJSPSKTFP-RMKNXTFCSA-N |
| XLogP | 2.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid?
The IUPAC name of (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid (CID 155676462) is (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid.
What is the SMILES notation for (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid?
The canonical SMILES for (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid is O=C(O)/C=C1\CCCc2ccc(Br)cc2C1=O.
What is the InChIKey of (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid?
The InChIKey is MNTABAJSPSKTFP-RMKNXTFCSA-N. The full InChI is InChI=1S/C13H11BrO3/c14-10-5-4-8-2-1-3-9(6-12(15)16)13(17)11(8)7-10/h4-7H,1-3H2,(H,15,16)/b9-6+.
What are the key properties of (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid?
(2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid has a molecular weight of 295.13 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(3-bromo-5-oxo-8,9-dihydro-7H-benzo[7]annulen-6-ylidene)acetic acid is sourced from PubChem (CID 155676462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).