About buta-1,3-diene;1-methylpyrrolidin-2-one
buta-1,3-diene;1-methylpyrrolidin-2-one (PubChem CID 155676528) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is buta-1,3-diene;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | buta-1,3-diene;1-methylpyrrolidin-2-one |
| PubChem CID | 155676528 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | buta-1,3-diene;1-methylpyrrolidin-2-one |
| SMILES | C=CC=C.CN1CCCC1=O |
| InChI | InChI=1S/C5H9NO.C4H6/c1-6-4-2-3-5(6)7;1-3-4-2/h2-4H2,1H3;3-4H,1-2H2 |
| InChIKey | KZAQYUQSTUKUGB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;1-methylpyrrolidin-2-one?
The IUPAC name of buta-1,3-diene;1-methylpyrrolidin-2-one (CID 155676528) is buta-1,3-diene;1-methylpyrrolidin-2-one.
What is the SMILES notation for buta-1,3-diene;1-methylpyrrolidin-2-one?
The canonical SMILES for buta-1,3-diene;1-methylpyrrolidin-2-one is C=CC=C.CN1CCCC1=O.
What is the InChIKey of buta-1,3-diene;1-methylpyrrolidin-2-one?
The InChIKey is KZAQYUQSTUKUGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C4H6/c1-6-4-2-3-5(6)7;1-3-4-2/h2-4H2,1H3;3-4H,1-2H2.
What are the key properties of buta-1,3-diene;1-methylpyrrolidin-2-one?
buta-1,3-diene;1-methylpyrrolidin-2-one has a molecular weight of 153.22 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;1-methylpyrrolidin-2-one is sourced from PubChem (CID 155676528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).