C11H6ClF3N2S — CID 155676639
1-(2-chloro-1,3-thiazol-5-yl)-N-[2-(trifluoromethyl)phenyl]methanimine (PubChem CID 155676639) has the molecular formula C11H6ClF3N2S and a molecular weight of 290.70 g/mol. Its IUPAC name is 1-(2-chloro-1,3-thiazol-5-yl)-N-[2-(trifluoromethyl)phenyl]methanimine.
| Compound Name | 1-(2-chloro-1,3-thiazol-5-yl)-N-[2-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 155676639 |
| Molecular Formula | C11H6ClF3N2S |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 1-(2-chloro-1,3-thiazol-5-yl)-N-[2-(trifluoromethyl)phenyl]methanimine |
| SMILES | FC(F)(F)c1ccccc1/N=C/c1cnc(Cl)s1 |
| InChI | InChI=1S/C11H6ClF3N2S/c12-10-17-6-7(18-10)5-16-9-4-2-1-3-8(9)11(13,14)15/h1-6H/b16-5+ |
| InChIKey | YOQWNBIVUQBYSV-FZSIALSZSA-N |
| XLogP | 4.57 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|