About 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine
4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine (PubChem CID 15567751) has the molecular formula C7H9Cl2N3S
and a molecular weight of 238.14 g/mol. Its IUPAC name is 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine |
| PubChem CID | 15567751 |
| Molecular Formula | C7H9Cl2N3S |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine |
| SMILES | CSc1c(Cl)nc(N(C)C)nc1Cl |
| InChI | InChI=1S/C7H9Cl2N3S/c1-12(2)7-10-5(8)4(13-3)6(9)11-7/h1-3H3 |
| InChIKey | SUARBYKFCNHIFT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine?
The IUPAC name of 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine (CID 15567751) is 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine.
What is the SMILES notation for 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine?
The canonical SMILES for 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine is CSc1c(Cl)nc(N(C)C)nc1Cl.
What is the InChIKey of 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine?
The InChIKey is SUARBYKFCNHIFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl2N3S/c1-12(2)7-10-5(8)4(13-3)6(9)11-7/h1-3H3.
What are the key properties of 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine?
4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine has a molecular weight of 238.14 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-N,N-dimethyl-5-methylsulfanylpyrimidin-2-amine is sourced from PubChem (CID 15567751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).