About 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one
3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one (PubChem CID 155677597) has the molecular formula C25H20F2N4O4
and a molecular weight of 478.46 g/mol. Its IUPAC name is 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one.
Molecular Properties
| Compound Name | 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one |
| PubChem CID | 155677597 |
| Molecular Formula | C25H20F2N4O4 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one |
| SMILES | CC(=O)c1c(N2CCOCC2)c2ccc(Nc3nccc(-c4c(F)cccc4F)n3)cc2oc1=O |
| InChI | InChI=1S/C25H20F2N4O4/c1-14(32)21-23(31-9-11-34-12-10-31)16-6-5-15(13-20(16)35-24(21)33)29-25-28-8-7-19(30-25)22-17(26)3-2-4-18(22)27/h2-8,13H,9-12H2,1H3,(H,28,29,30) |
| InChIKey | GUNJVVRBBQEUJG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one?
The IUPAC name of 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one (CID 155677597) is 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one.
What is the SMILES notation for 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one?
The canonical SMILES for 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one is CC(=O)c1c(N2CCOCC2)c2ccc(Nc3nccc(-c4c(F)cccc4F)n3)cc2oc1=O.
What is the InChIKey of 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one?
The InChIKey is GUNJVVRBBQEUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20F2N4O4/c1-14(32)21-23(31-9-11-34-12-10-31)16-6-5-15(13-20(16)35-24(21)33)29-25-28-8-7-19(30-25)22-17(26)3-2-4-18(22)27/h2-8,13H,9-12H2,1H3,(H,28,29,30).
What are the key properties of 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one?
3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one has a molecular weight of 478.46 g/mol, XLogP of 4.31, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-7-[[4-(2,6-difluorophenyl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one is sourced from PubChem (CID 155677597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).