About 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone
1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone (PubChem CID 15567804) has the molecular formula C16H13FO2S
and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone |
| PubChem CID | 15567804 |
| Molecular Formula | C16H13FO2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)C(O)Cc1ccc(F)cc1S2 |
| InChI | InChI=1S/C16H13FO2S/c1-9(18)10-3-5-15-13(6-10)14(19)7-11-2-4-12(17)8-16(11)20-15/h2-6,8,14,19H,7H2,1H3 |
| InChIKey | UDZIMTIFNRZILJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone?
The IUPAC name of 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone (CID 15567804) is 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone.
What is the SMILES notation for 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone?
The canonical SMILES for 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone is CC(=O)c1ccc2c(c1)C(O)Cc1ccc(F)cc1S2.
What is the InChIKey of 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone?
The InChIKey is UDZIMTIFNRZILJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FO2S/c1-9(18)10-3-5-15-13(6-10)14(19)7-11-2-4-12(17)8-16(11)20-15/h2-6,8,14,19H,7H2,1H3.
What are the key properties of 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone?
1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone has a molecular weight of 288.34 g/mol, XLogP of 3.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9-fluoro-5-hydroxy-5,6-dihydrobenzo[b][1]benzothiepin-3-yl)ethanone is sourced from PubChem (CID 15567804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).