C24H38O3Si — CID 155678997
[(1S,4S,5S)-4-[4-[butyl(dimethyl)silyl]-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol (PubChem CID 155678997) has the molecular formula C24H38O3Si and a molecular weight of 402.65 g/mol. Its IUPAC name is [(1S,4S,5S)-4-[4-[butyl(dimethyl)silyl]-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol.
| Compound Name | [(1S,4S,5S)-4-[4-[butyl(dimethyl)silyl]-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol |
|---|---|
| PubChem CID | 155678997 |
| Molecular Formula | C24H38O3Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | [(1S,4S,5S)-4-[4-[butyl(dimethyl)silyl]-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol |
| SMILES | CCCC[Si](C)(C)c1cc(OC)c([C@H]2C=C(CO)[C@H]3C[C@@H]2C3(C)C)c(OC)c1 |
| InChI | InChI=1S/C24H38O3Si/c1-8-9-10-28(6,7)17-12-21(26-4)23(22(13-17)27-5)18-11-16(15-25)19-14-20(18)24(19,2)3/h11-13,18-20,25H,8-10,14-15H2,1-7H3/t18-,19+,20-/m0/s1 |
| InChIKey | VMOGEWRHMQUTPA-ZCNNSNEGSA-N |
| XLogP | 5.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|