C29H40N6O2Si — CID 155679578
2-[(1S,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-7-[2-(oxan-2-yl)pyrazol-3-yl]pyrazolo[4,3-c]quinolin-4-amine (PubChem CID 155679578) has the molecular formula C29H40N6O2Si and a molecular weight of 532.77 g/mol. Its IUPAC name is 2-[(1S,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-7-[2-(oxan-2-yl)pyrazol-3-yl]pyrazolo[4,3-c]quinolin-4-amine.
| Compound Name | 2-[(1S,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-7-[2-(oxan-2-yl)pyrazol-3-yl]pyrazolo[4,3-c]quinolin-4-amine |
|---|---|
| PubChem CID | 155679578 |
| Molecular Formula | C29H40N6O2Si |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 2-[(1S,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-7-[2-(oxan-2-yl)pyrazol-3-yl]pyrazolo[4,3-c]quinolin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@H](n2cc3c(N)nc4cc(-c5ccnn5C5CCCCO5)ccc4c3n2)C1 |
| InChI | InChI=1S/C29H40N6O2Si/c1-29(2,3)38(4,5)37-21-11-10-20(17-21)34-18-23-27(33-34)22-12-9-19(16-24(22)32-28(23)30)25-13-14-31-35(25)26-8-6-7-15-36-26/h9,12-14,16,18,20-21,26H,6-8,10-11,15,17H2,1-5H3,(H2,30,32)/t20-,21+,26?/m0/s1 |
| InChIKey | OJXQYQFVNZYMPZ-IEDSLXKASA-N |
| XLogP | 6.84 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|