C41H40N6O3 — CID 155679628
2-[(2R)-2-methoxy-3-trityloxypropyl]-7-[2-(oxan-2-yl)pyrazol-3-yl]pyrazolo[4,3-c]quinolin-4-amine (PubChem CID 155679628) has the molecular formula C41H40N6O3 and a molecular weight of 664.81 g/mol. Its IUPAC name is 2-[(2R)-2-methoxy-3-trityloxypropyl]-7-[2-(oxan-2-yl)pyrazol-3-yl]pyrazolo[4,3-c]quinolin-4-amine.
| Compound Name | 2-[(2R)-2-methoxy-3-trityloxypropyl]-7-[2-(oxan-2-yl)pyrazol-3-yl]pyrazolo[4,3-c]quinolin-4-amine |
|---|---|
| PubChem CID | 155679628 |
| Molecular Formula | C41H40N6O3 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.32 |
| IUPAC Name | 2-[(2R)-2-methoxy-3-trityloxypropyl]-7-[2-(oxan-2-yl)pyrazol-3-yl]pyrazolo[4,3-c]quinolin-4-amine |
| SMILES | CO[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)Cn1cc2c(N)nc3cc(-c4ccnn4C4CCCCO4)ccc3c2n1 |
| InChI | InChI=1S/C41H40N6O3/c1-48-33(28-50-41(30-13-5-2-6-14-30,31-15-7-3-8-16-31)32-17-9-4-10-18-32)26-46-27-35-39(45-46)34-21-20-29(25-36(34)44-40(35)42)37-22-23-43-47(37)38-19-11-12-24-49-38/h2-10,13-18,20-23,25,27,33,38H,11-12,19,24,26,28H2,1H3,(H2,42,44)/t33-,38?/m1/s1 |
| InChIKey | SKWYUZONLFUQGW-OVFDOZPJSA-N |
| XLogP | 7.75 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|