About 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole
3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole (PubChem CID 155679823) has the molecular formula C16H10F3NSe
and a molecular weight of 352.22 g/mol. Its IUPAC name is 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole.
Molecular Properties
| Compound Name | 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole |
| PubChem CID | 155679823 |
| Molecular Formula | C16H10F3NSe |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole |
| SMILES | FC(F)(F)c1ccc(-c2cc(-c3ccccc3)n[se]2)cc1 |
| InChI | InChI=1S/C16H10F3NSe/c17-16(18,19)13-8-6-12(7-9-13)15-10-14(20-21-15)11-4-2-1-3-5-11/h1-10H |
| InChIKey | SGDHIVZUKUVIJJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole?
The IUPAC name of 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole (CID 155679823) is 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole.
What is the SMILES notation for 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole?
The canonical SMILES for 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole is FC(F)(F)c1ccc(-c2cc(-c3ccccc3)n[se]2)cc1.
What is the InChIKey of 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole?
The InChIKey is SGDHIVZUKUVIJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F3NSe/c17-16(18,19)13-8-6-12(7-9-13)15-10-14(20-21-15)11-4-2-1-3-5-11/h1-10H.
What are the key properties of 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole?
3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole has a molecular weight of 352.22 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-5-[4-(trifluoromethyl)phenyl]-1,2-selenazole is sourced from PubChem (CID 155679823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).