C32H34FN9O2 — CID 155680259
N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-(4-fluoroanilino)-9-phenylpurin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 155680259) has the molecular formula C32H34FN9O2 and a molecular weight of 595.68 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-(4-fluoroanilino)-9-phenylpurin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-(4-fluoroanilino)-9-phenylpurin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155680259 |
| Molecular Formula | C32H34FN9O2 |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-(4-fluoroanilino)-9-phenylpurin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc3nc(Nc4ccc(F)cc4)n(-c4ccccc4)c3n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C32H34FN9O2/c1-6-29(43)36-24-18-25(28(44-5)19-27(24)41(4)17-16-40(2)3)37-31-34-20-26-30(39-31)42(23-10-8-7-9-11-23)32(38-26)35-22-14-12-21(33)13-15-22/h6-15,18-20H,1,16-17H2,2-5H3,(H,35,38)(H,36,43)(H,34,37,39) |
| InChIKey | HDOSGOVOLYIRIU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|