C23H25Cl2FN6O2 — CID 155680319
tert-butyl 4-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]piperidine-1-carboxylate (PubChem CID 155680319) has the molecular formula C23H25Cl2FN6O2 and a molecular weight of 507.40 g/mol. Its IUPAC name is tert-butyl 4-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155680319 |
| Molecular Formula | C23H25Cl2FN6O2 |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | tert-butyl 4-[[4-(3,4-dichloro-2-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cn2)CC1 |
| InChI | InChI=1S/C23H25Cl2FN6O2/c1-23(2,3)34-22(33)32-8-6-13(7-9-32)30-18-10-14-17(11-27-18)28-12-29-21(14)31-16-5-4-15(24)19(25)20(16)26/h4-5,10-13H,6-9H2,1-3H3,(H,27,30)(H,28,29,31) |
| InChIKey | VLIOMERWQYDYIA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|